L-Cysteine, S-(phenylmethyl)-, S-oxide CAS NO.60668-81-7

1. Introduction of L-Cysteine, S-(phenylmethyl)-, S-oxide (CAS No.:60668-81-7)
With the CAS registry number 60668-81-7,L-Cysteine, S-(phenylmethyl)-, S-oxide is also kno

1. Introduction of L-Cysteine, S-(phenylmethyl)-, S-oxide (CAS No.:60668-81-7)
With the CAS registry number 60668-81-7, L-Cysteine, S-(phenylmethyl)-, S-oxide is also known as S-Benzyl-L-cystein-S-oxide. This chemical's molecular formula is C₁₀H₁₃NO₃S and molecular weight is 227.28. What's more, its systematic name is 3-(benzylsulfinyl)alanine.

2. Properties of L-Cysteine, S-(phenylmethyl)-, S-oxide (CAS No.:60668-81-7)
Density: 1.39 g/cm³
Boiling Point: 504.5 °C at 760 mmHg
Flash Point: 258.9 °C

3. Structure Descriptors of L-Cysteine, S-(phenylmethyl)-, S-oxide (CAS No.:60668-81-7)
(1)Canonical SMILES: C1=CC=C(C=C1)CS(=O)CC(C(=O)O)N
(2)InChI: InChI=1S/C10H13NO3S/c11-9(10(12)13)7-15(14)6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)
(3)InChIKey: OBQBHBOGTLPNJM-UHFFFAOYSA-N