2-Propenal,3-[1,1'-biphenyl]-4-yl-, (2E)- CAS NO.113538-22-0

1. Introduction of2-Propenal,3-[1,1'-biphenyl]-4-yl-, (2E)- (CAS No.:113538-22-0)
With the CAS registry number of 113538-22-0, 2-Propenal,3-[1,1'-biphenyl]-4-yl-, (2E)-

1. Introduction of 2-Propenal,3-[1,1'-biphenyl]-4-yl-, (2E)- (CAS No.:113538-22-0)
With the CAS registry number of 113538-22-0, 2-Propenal,3-[1,1'-biphenyl]-4-yl-, (2E)- is also known as 4-Phenylcinnamadehyde. This chemical's molecular formula is C₁₅H₁₂O and the molecular weight is 208.26. What's more, its systematic name is (2E)-3-Biphenyl-4-ylprop-2-enal.

2. Properties of 2-Propenal,3-[1,1'-biphenyl]-4-yl-, (2E)- (CAS No.:113538-22-0)
Density: 1.078 g/cm³
Boiling Point: 383.5 °C at 760 mmHg
Flash Point: 147.8 °C

3. Structure Descriptors of 2-Propenal,3-[1,1'-biphenyl]-4-yl-, (2E)- (CAS No.:113538-22-0)
(1)SMILES: O=C\C=C\c2ccc(c1ccccc1)cc2
(2)InChI: InChI=1S/C15H12O/c16-12-4-5-13-8-10-15(11-9-13)14-6-2-1-3-7-14/h1-12H/b5-4+
(3)InChIKey: DEGNTTFHGNUFKP-SNAWJCMRSA-N