N-Cbz-L-homoserine lactone CAS NO.35677-89-5

1. Introduction ofN-Cbz-L-homoserine lactone (CAS No.:35677-89-5)
N-Cbz-L-homoserine lactone canalso be called N-((3R)-2-Oxo(3-3,4,5-trihydrofuryl))(phenylmethoxy)carbox

1. Introduction of N-Cbz-L-homoserine lactone (CAS No.:35677-89-5)
N-Cbz-L-homoserine lactone can also be called N-((3R)-2-Oxo(3-3,4,5-trihydrofuryl))(phenylmethoxy)carboxamide. The molecular formula is C₁₂H₁₃NO₄ and molecular weight is 235.24

2. Properties of N-Cbz-L-homoserine lactone (CAS No.:35677-89-5)
Density: 1.27 g/cm³
Melting Point: 127-132 °C
Surface Tension: 50 dyne/cm
Flash Point: 235.7 °C
Enthalpy of Vaporization: 72.78 kJ/mol
Boiling Point: 466.1 °C at 760 mmHg
Vapour Pressure: 7.29E-09 mmHg at 25°C

3. Safety Information of N-Cbz-L-homoserine lactone (CAS No.:35677-89-5)
Safety Statements: 22-24/25
S22:Do not breathe dust.
S24/25:Avoid contact with skin and eyes.
WGK Germany: 3
F: 10

4. Structure Descriptors of N-Cbz-L-homoserine lactone (CAS No.:35677-89-5)
SMILES:c1cccc(c1)COC(=O)N[C@@H]1C(=O)OCC1