S-Methyl-L-cysteine sulfoxide CAS NO.6853-87-8

1. Introduction of S-Methyl-L-cysteine sulfoxide (CAS No.:6853-87-8)
With the CAS registry number of 6853-87-8,S-Methyl-L-cysteine sulfoxide is also known asL-Cysteine,

1. Introduction of S-Methyl-L-cysteine sulfoxide (CAS No.:6853-87-8)
With the CAS registry number of 6853-87-8, S-Methyl-L-cysteine sulfoxide is also known as L-Cysteine, S-methyl-,S-oxide. The molecular formula of S-Methyl-L-cysteine sulfoxide is C₄H₉NO₃S and molecular weight is 151.18. What's more, its systematic name is called Alanine, 3-(methylsulfinyl)-, L-, pyrolyzate.

2. Properties of S-Methyl-L-cysteine sulfoxide (CAS No.:6853-87-8)
Density: 1.471 g/cm³
Boiling Point: 428.232 °C at 760 mmHg
Flash Point: 212.787 °C

3. Structure Descriptors of S-Methyl-L-cysteine sulfoxide (CAS No.:6853-87-8)
(1) SMILES: O=C(O)[C@H](N)CS(=O)C
(2) InChI: InChI=1S/C4H9NO3S/c1-9(8)2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-,9 /m1/s1
(3) InChIKey: ZZLHPCSGGOGHFW-ZMQIUWNVSA-N