(2E)-3-(4-Biphenylyl)acrylic acid CAS NO.88241-65-0

1. Introduction of(2E)-3-(4-Biphenylyl)acrylic acid (CAS No.: 88241-65-0)
With the CAS registry number 88241-65-0, (2E)-3-(4-Biphenylyl)acrylic acid is also known as2-Pr

1. Introduction of (2E)-3-(4-Biphenylyl)acrylic acid (CAS No.: 88241-65-0)
With the CAS registry number 88241-65-0, (2E)-3-(4-Biphenylyl)acrylic acid is also known as 2-Propenoic acid,3-[1,1'-biphenyl]-4-yl-, (2E)-. This chemical's molecular formula is C₁₅H₁₂O₂ and the molecular weight is 224.25.

2. Properties of (2E)-3-(4-Biphenylyl)acrylic acid (CAS No.: 88241-65-0)
Density: 1.178 g/cm³
Melting Point: 224-228 °C
Boiling Point: 412.912 °C at 760 mmHg
Flash Point: 308.021 °C

3. Structure Descriptors of (2E)-3-(4-Biphenylyl)acrylic acid (CAS No.: 88241-65-0)
(1) SMILES: O=C(O)\C=C\c2ccc(c1ccccc1)cc2
(2) InChI: InChI=1S/C15H12O2/c16-15(17)11-8-12-6-9-14(10-7-12)13-4-2-1-3-5-13/h1-11H,(H,16,17)/b11-8+
(3) InChIKey: DMJDEZUEYXVYNO-DHZHZOJOSA-N